C25H34O8 — CID 51006780
4-[2-[(17R)-11,17-dihydroxy-10,12-dimethyl-3-oxo-1,2,6,7,8,9,11,12,13,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethoxy]-4-oxobutanoic acid (PubChem CID 51006780) has the molecular formula C25H34O8 and a molecular weight of 462.54 g/mol. Its IUPAC name is 4-[2-[(17R)-11,17-dihydroxy-10,12-dimethyl-3-oxo-1,2,6,7,8,9,11,12,13,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethoxy]-4-oxobutanoic acid.
| Compound Name | 4-[2-[(17R)-11,17-dihydroxy-10,12-dimethyl-3-oxo-1,2,6,7,8,9,11,12,13,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethoxy]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 51006780 |
| Molecular Formula | C25H34O8 |
| Molecular Weight | 462.54 g/mol |
| Exact Mass | 462.23 |
| IUPAC Name | 4-[2-[(17R)-11,17-dihydroxy-10,12-dimethyl-3-oxo-1,2,6,7,8,9,11,12,13,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethoxy]-4-oxobutanoic acid |
| SMILES | CC1C(O)C2C(CCC3=CC(=O)CCC32C)C2CC[C@](O)(C(=O)COC(=O)CCC(=O)O)C12 |
| InChI | InChI=1S/C25H34O8/c1-13-21-17(8-10-25(21,32)18(27)12-33-20(30)6-5-19(28)29)16-4-3-14-11-15(26)7-9-24(14,2)22(16)23(13)31/h11,13,16-17,21-23,31-32H,3-10,12H2,1-2H3,(H,28,29)/t13?,16?,17?,21?,22?,23?,24?,25-/m0/s1 |
| InChIKey | GXYHOHAOQFJCPN-CJHPYPSNSA-N |
| XLogP | 2.05 |
| TPSA | 138.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.54 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |