C28H31NO4 — CID 51006809
(3S,4R,7R,13S,14S,16R,20S)-13-ethenyl-7-methyl-2-oxa-18-azahexacyclo[20.2.2.13,10.04,9.016,20.014,27]heptacosa-1(25),11,22(26),23-tetraene-15,17,19-trione (PubChem CID 51006809) has the molecular formula C28H31NO4 and a molecular weight of 445.56 g/mol. Its IUPAC name is (3S,4R,7R,13S,14S,16R,20S)-13-ethenyl-7-methyl-2-oxa-18-azahexacyclo[20.2.2.13,10.04,9.016,20.014,27]heptacosa-1(25),11,22(26),23-tetraene-15,17,19-trione.
| Compound Name | (3S,4R,7R,13S,14S,16R,20S)-13-ethenyl-7-methyl-2-oxa-18-azahexacyclo[20.2.2.13,10.04,9.016,20.014,27]heptacosa-1(25),11,22(26),23-tetraene-15,17,19-trione |
|---|---|
| PubChem CID | 51006809 |
| Molecular Formula | C28H31NO4 |
| Molecular Weight | 445.56 g/mol |
| Exact Mass | 445.23 |
| IUPAC Name | (3S,4R,7R,13S,14S,16R,20S)-13-ethenyl-7-methyl-2-oxa-18-azahexacyclo[20.2.2.13,10.04,9.016,20.014,27]heptacosa-1(25),11,22(26),23-tetraene-15,17,19-trione |
| SMILES | C=C[C@H]1C=CC2C3C[C@H](C)CC[C@H]3[C@@H]3Oc4ccc(cc4)C[C@@H]4C(=O)NC(=O)[C@H]4C(=O)[C@@H]1C23 |
| InChI | InChI=1S/C28H31NO4/c1-3-16-7-11-18-20-12-14(2)4-10-19(20)26-23(18)22(16)25(30)24-21(27(31)29-28(24)32)13-15-5-8-17(33-26)9-6-15/h3,5-9,11,14,16,18-24,26H,1,4,10,12-13H2,2H3,(H,29,31,32)/t14-,16+,18?,19-,20?,21+,22+,23?,24-,26+/m1/s1 |
| InChIKey | ZEHNBMLTLKOFTM-XWEIMHJRSA-N |
| XLogP | 3.73 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.56 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|