About 2,3-dioxo-1,4-dihydroquinoxaline-6-carbonitrile
2,3-dioxo-1,4-dihydroquinoxaline-6-carbonitrile (PubChem CID 5100691) has the molecular formula C9H5N3O2
and a molecular weight of 187.16 g/mol. Its IUPAC name is 2,3-dioxo-1,4-dihydroquinoxaline-6-carbonitrile.
Molecular Properties
| Compound Name | 2,3-dioxo-1,4-dihydroquinoxaline-6-carbonitrile |
| PubChem CID | 5100691 |
| Molecular Formula | C9H5N3O2 |
| Molecular Weight | 187.16 g/mol |
| Exact Mass | 187.04 |
| IUPAC Name | 2,3-dioxo-1,4-dihydroquinoxaline-6-carbonitrile |
| SMILES | N#Cc1ccc2[nH]c(=O)c(=O)[nH]c2c1 |
| InChI | InChI=1S/C9H5N3O2/c10-4-5-1-2-6-7(3-5)12-9(14)8(13)11-6/h1-3H,(H,11,13)(H,12,14) |
| InChIKey | NBOKWKXETLTPQV-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 89.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.16 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 2,3-dioxo-1,4-dihydroquinoxaline-6-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dioxo-1,4-dihydroquinoxaline-6-carbonitrile?
The IUPAC name of 2,3-dioxo-1,4-dihydroquinoxaline-6-carbonitrile (CID 5100691) is 2,3-dioxo-1,4-dihydroquinoxaline-6-carbonitrile.
What is the SMILES notation for 2,3-dioxo-1,4-dihydroquinoxaline-6-carbonitrile?
The canonical SMILES for 2,3-dioxo-1,4-dihydroquinoxaline-6-carbonitrile is N#Cc1ccc2[nH]c(=O)c(=O)[nH]c2c1.
What is the InChIKey of 2,3-dioxo-1,4-dihydroquinoxaline-6-carbonitrile?
The InChIKey is NBOKWKXETLTPQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H5N3O2/c10-4-5-1-2-6-7(3-5)12-9(14)8(13)11-6/h1-3H,(H,11,13)(H,12,14).
What are the key properties of 2,3-dioxo-1,4-dihydroquinoxaline-6-carbonitrile?
2,3-dioxo-1,4-dihydroquinoxaline-6-carbonitrile has a molecular weight of 187.16 g/mol, XLogP of 0.09, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dioxo-1,4-dihydroquinoxaline-6-carbonitrile is sourced from PubChem (CID 5100691), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).