C23H32O4 — CID 510089
3-[[(1S,4aR)-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl]methoxy]-3-oxopropanoic acid (PubChem CID 510089) has the molecular formula C23H32O4 and a molecular weight of 372.51 g/mol. Its IUPAC name is 3-[[(1S,4aR)-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl]methoxy]-3-oxopropanoic acid.
| Compound Name | 3-[[(1S,4aR)-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl]methoxy]-3-oxopropanoic acid |
|---|---|
| PubChem CID | 510089 |
| Molecular Formula | C23H32O4 |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.23 |
| IUPAC Name | 3-[[(1S,4aR)-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl]methoxy]-3-oxopropanoic acid |
| SMILES | CC(C)c1ccc2c(c1)CCC1[C@@](C)(COC(=O)CC(=O)O)CCC[C@@]21C |
| InChI | InChI=1S/C23H32O4/c1-15(2)16-6-8-18-17(12-16)7-9-19-22(3,10-5-11-23(18,19)4)14-27-21(26)13-20(24)25/h6,8,12,15,19H,5,7,9-11,13-14H2,1-4H3,(H,24,25)/t19?,22-,23+/m1/s1 |
| InChIKey | CTEBYFKLDQEMJB-XDQLBQEWSA-N |
| XLogP | 4.84 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|