About 4,7-dimethoxy-1H-indole
4,7-dimethoxy-1H-indole (PubChem CID 510119) has the molecular formula C10H11NO2
and a molecular weight of 177.20 g/mol. Its IUPAC name is 4,7-dimethoxy-1H-indole.
Molecular Properties
| Compound Name | 4,7-dimethoxy-1H-indole |
| PubChem CID | 510119 |
| Molecular Formula | C10H11NO2 |
| Molecular Weight | 177.20 g/mol |
| Exact Mass | 177.08 |
| IUPAC Name | 4,7-dimethoxy-1H-indole |
| SMILES | COc1ccc(OC)c2[nH]ccc12 |
| InChI | InChI=1S/C10H11NO2/c1-12-8-3-4-9(13-2)10-7(8)5-6-11-10/h3-6,11H,1-2H3 |
| InChIKey | OUDGAYDZZUTPPC-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 34.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.20 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4,7-dimethoxy-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,7-dimethoxy-1H-indole?
The IUPAC name of 4,7-dimethoxy-1H-indole (CID 510119) is 4,7-dimethoxy-1H-indole.
What is the SMILES notation for 4,7-dimethoxy-1H-indole?
The canonical SMILES for 4,7-dimethoxy-1H-indole is COc1ccc(OC)c2[nH]ccc12.
What is the InChIKey of 4,7-dimethoxy-1H-indole?
The InChIKey is OUDGAYDZZUTPPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NO2/c1-12-8-3-4-9(13-2)10-7(8)5-6-11-10/h3-6,11H,1-2H3.
What are the key properties of 4,7-dimethoxy-1H-indole?
4,7-dimethoxy-1H-indole has a molecular weight of 177.20 g/mol, XLogP of 2.19, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,7-dimethoxy-1H-indole is sourced from PubChem (CID 510119), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).