About (1R,4S)-2-[(S)-(4-methylphenyl)sulfinyl]bicyclo[2.2.1]hepta-2,5-diene
(1R,4S)-2-[(S)-(4-methylphenyl)sulfinyl]bicyclo[2.2.1]hepta-2,5-diene (PubChem CID 51012800) has the molecular formula C14H14OS
and a molecular weight of 230.33 g/mol. Its IUPAC name is (1R,4S)-2-[(S)-(4-methylphenyl)sulfinyl]bicyclo[2.2.1]hepta-2,5-diene.
Molecular Properties
| Compound Name | (1R,4S)-2-[(S)-(4-methylphenyl)sulfinyl]bicyclo[2.2.1]hepta-2,5-diene |
| PubChem CID | 51012800 |
| Molecular Formula | C14H14OS |
| Molecular Weight | 230.33 g/mol |
| Exact Mass | 230.08 |
| IUPAC Name | (1R,4S)-2-[(S)-(4-methylphenyl)sulfinyl]bicyclo[2.2.1]hepta-2,5-diene |
| SMILES | Cc1ccc([S@](=O)C2=C[C@@H]3C=C[C@H]2C3)cc1 |
| InChI | InChI=1S/C14H14OS/c1-10-2-6-13(7-3-10)16(15)14-9-11-4-5-12(14)8-11/h2-7,9,11-12H,8H2,1H3/t11-,12+,16+/m1/s1 |
| InChIKey | JJUMPLXRBILKNG-WQGACYEGSA-N |
| XLogP | 3.19 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.33 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (1R,4S)-2-[(S)-(4-methylphenyl)sulfinyl]bicyclo[2.2.1]hepta-2,5-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R,4S)-2-[(S)-(4-methylphenyl)sulfinyl]bicyclo[2.2.1]hepta-2,5-diene?
The IUPAC name of (1R,4S)-2-[(S)-(4-methylphenyl)sulfinyl]bicyclo[2.2.1]hepta-2,5-diene (CID 51012800) is (1R,4S)-2-[(S)-(4-methylphenyl)sulfinyl]bicyclo[2.2.1]hepta-2,5-diene.
What is the SMILES notation for (1R,4S)-2-[(S)-(4-methylphenyl)sulfinyl]bicyclo[2.2.1]hepta-2,5-diene?
The canonical SMILES for (1R,4S)-2-[(S)-(4-methylphenyl)sulfinyl]bicyclo[2.2.1]hepta-2,5-diene is Cc1ccc([S@](=O)C2=C[C@@H]3C=C[C@H]2C3)cc1.
What is the InChIKey of (1R,4S)-2-[(S)-(4-methylphenyl)sulfinyl]bicyclo[2.2.1]hepta-2,5-diene?
The InChIKey is JJUMPLXRBILKNG-WQGACYEGSA-N. The full InChI is InChI=1S/C14H14OS/c1-10-2-6-13(7-3-10)16(15)14-9-11-4-5-12(14)8-11/h2-7,9,11-12H,8H2,1H3/t11-,12+,16+/m1/s1.
What are the key properties of (1R,4S)-2-[(S)-(4-methylphenyl)sulfinyl]bicyclo[2.2.1]hepta-2,5-diene?
(1R,4S)-2-[(S)-(4-methylphenyl)sulfinyl]bicyclo[2.2.1]hepta-2,5-diene has a molecular weight of 230.33 g/mol, XLogP of 3.19, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1R,4S)-2-[(S)-(4-methylphenyl)sulfinyl]bicyclo[2.2.1]hepta-2,5-diene is sourced from PubChem (CID 51012800), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).