C24H40NO2+ — CID 5101318
1-benzyl-1-[[2-(2,4,4-trimethylpentyl)-1,3-dioxolan-4-yl]methyl]piperidin-1-ium (PubChem CID 5101318) has the molecular formula C24H40NO2+ and a molecular weight of 374.59 g/mol. Its IUPAC name is 1-benzyl-1-[[2-(2,4,4-trimethylpentyl)-1,3-dioxolan-4-yl]methyl]piperidin-1-ium.
| Compound Name | 1-benzyl-1-[[2-(2,4,4-trimethylpentyl)-1,3-dioxolan-4-yl]methyl]piperidin-1-ium |
|---|---|
| PubChem CID | 5101318 |
| Molecular Formula | C24H40NO2+ |
| Molecular Weight | 374.59 g/mol |
| Exact Mass | 374.31 |
| IUPAC Name | 1-benzyl-1-[[2-(2,4,4-trimethylpentyl)-1,3-dioxolan-4-yl]methyl]piperidin-1-ium |
| SMILES | CC(CC1OCC(C[N+]2(Cc3ccccc3)CCCCC2)O1)CC(C)(C)C |
| InChI | InChI=1S/C24H40NO2/c1-20(16-24(2,3)4)15-23-26-19-22(27-23)18-25(13-9-6-10-14-25)17-21-11-7-5-8-12-21/h5,7-8,11-12,20,22-23H,6,9-10,13-19H2,1-4H3/q+1 |
| InChIKey | ORHCJMDTXKANRH-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.59 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|