C19H23NO2 — CID 51013573
(1S,2R,5S,8R)-5-benzyl-1,11,11-trimethyl-3-oxa-6-azatricyclo[6.2.1.02,7]undec-6-en-4-one (PubChem CID 51013573) has the molecular formula C19H23NO2 and a molecular weight of 297.40 g/mol. Its IUPAC name is (1S,2R,5S,8R)-5-benzyl-1,11,11-trimethyl-3-oxa-6-azatricyclo[6.2.1.02,7]undec-6-en-4-one.
| Compound Name | (1S,2R,5S,8R)-5-benzyl-1,11,11-trimethyl-3-oxa-6-azatricyclo[6.2.1.02,7]undec-6-en-4-one |
|---|---|
| PubChem CID | 51013573 |
| Molecular Formula | C19H23NO2 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | (1S,2R,5S,8R)-5-benzyl-1,11,11-trimethyl-3-oxa-6-azatricyclo[6.2.1.02,7]undec-6-en-4-one |
| SMILES | CC1(C)[C@H]2CC[C@]1(C)[C@H]1OC(=O)[C@H](Cc3ccccc3)N=C21 |
| InChI | InChI=1S/C19H23NO2/c1-18(2)13-9-10-19(18,3)16-15(13)20-14(17(21)22-16)11-12-7-5-4-6-8-12/h4-8,13-14,16H,9-11H2,1-3H3/t13-,14-,16-,19+/m0/s1 |
| InChIKey | IIKJGKSNAIFONH-IWKLRQMXSA-N |
| XLogP | 3.42 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |