C5H5Cl3N2OS — CID 5101465
2,2,2-trichloro-N-(2,5-dihydro-1,3-thiazol-2-yl)acetamide (PubChem CID 5101465) has the molecular formula C5H5Cl3N2OS and a molecular weight of 247.53 g/mol. Its IUPAC name is 2,2,2-trichloro-N-(2,5-dihydro-1,3-thiazol-2-yl)acetamide.
| Compound Name | 2,2,2-trichloro-N-(2,5-dihydro-1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 5101465 |
| Molecular Formula | C5H5Cl3N2OS |
| Molecular Weight | 247.53 g/mol |
| Exact Mass | 245.92 |
| IUPAC Name | 2,2,2-trichloro-N-(2,5-dihydro-1,3-thiazol-2-yl)acetamide |
| SMILES | O=C(NC1N=CCS1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C5H5Cl3N2OS/c6-5(7,8)3(11)10-4-9-1-2-12-4/h1,4H,2H2,(H,10,11) |
| InChIKey | REKDXSLDLGQGSU-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.53 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|