C19H30O — CID 51015582
(1R,2S,3R,6S,7S)-4-nonyltricyclo[5.2.1.02,6]deca-4,8-dien-3-ol (PubChem CID 51015582) has the molecular formula C19H30O and a molecular weight of 274.45 g/mol. Its IUPAC name is (1R,2S,3R,6S,7S)-4-nonyltricyclo[5.2.1.02,6]deca-4,8-dien-3-ol.
| Compound Name | (1R,2S,3R,6S,7S)-4-nonyltricyclo[5.2.1.02,6]deca-4,8-dien-3-ol |
|---|---|
| PubChem CID | 51015582 |
| Molecular Formula | C19H30O |
| Molecular Weight | 274.45 g/mol |
| Exact Mass | 274.23 |
| IUPAC Name | (1R,2S,3R,6S,7S)-4-nonyltricyclo[5.2.1.02,6]deca-4,8-dien-3-ol |
| SMILES | CCCCCCCCCC1=C[C@H]2[C@H]([C@H]3C=C[C@@H]2C3)[C@H]1O |
| InChI | InChI=1S/C19H30O/c1-2-3-4-5-6-7-8-9-16-13-17-14-10-11-15(12-14)18(17)19(16)20/h10-11,13-15,17-20H,2-9,12H2,1H3/t14-,15+,17-,18+,19+/m1/s1 |
| InChIKey | RECGDDWDVQTXDL-PHAGKYIGSA-N |
| XLogP | 4.87 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.45 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|