About (1S,4R)-1-phenyl-2,3-diazabicyclo[2.2.1]hept-2-ene
(1S,4R)-1-phenyl-2,3-diazabicyclo[2.2.1]hept-2-ene (PubChem CID 51020607) has the molecular formula C11H12N2
and a molecular weight of 172.23 g/mol. Its IUPAC name is (1S,4R)-1-phenyl-2,3-diazabicyclo[2.2.1]hept-2-ene.
Molecular Properties
| Compound Name | (1S,4R)-1-phenyl-2,3-diazabicyclo[2.2.1]hept-2-ene |
| PubChem CID | 51020607 |
| Molecular Formula | C11H12N2 |
| Molecular Weight | 172.23 g/mol |
| Exact Mass | 172.10 |
| IUPAC Name | (1S,4R)-1-phenyl-2,3-diazabicyclo[2.2.1]hept-2-ene |
| SMILES | c1ccc([C@]23CC[C@H](C2)N=N3)cc1 |
| InChI | InChI=1S/C11H12N2/c1-2-4-9(5-3-1)11-7-6-10(8-11)12-13-11/h1-5,10H,6-8H2/t10-,11+/m1/s1 |
| InChIKey | GCORRSWBVUHVMN-MNOVXSKESA-N |
| XLogP | 2.90 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.23 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (1S,4R)-1-phenyl-2,3-diazabicyclo[2.2.1]hept-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S,4R)-1-phenyl-2,3-diazabicyclo[2.2.1]hept-2-ene?
The IUPAC name of (1S,4R)-1-phenyl-2,3-diazabicyclo[2.2.1]hept-2-ene (CID 51020607) is (1S,4R)-1-phenyl-2,3-diazabicyclo[2.2.1]hept-2-ene.
What is the SMILES notation for (1S,4R)-1-phenyl-2,3-diazabicyclo[2.2.1]hept-2-ene?
The canonical SMILES for (1S,4R)-1-phenyl-2,3-diazabicyclo[2.2.1]hept-2-ene is c1ccc([C@]23CC[C@H](C2)N=N3)cc1.
What is the InChIKey of (1S,4R)-1-phenyl-2,3-diazabicyclo[2.2.1]hept-2-ene?
The InChIKey is GCORRSWBVUHVMN-MNOVXSKESA-N. The full InChI is InChI=1S/C11H12N2/c1-2-4-9(5-3-1)11-7-6-10(8-11)12-13-11/h1-5,10H,6-8H2/t10-,11+/m1/s1.
What are the key properties of (1S,4R)-1-phenyl-2,3-diazabicyclo[2.2.1]hept-2-ene?
(1S,4R)-1-phenyl-2,3-diazabicyclo[2.2.1]hept-2-ene has a molecular weight of 172.23 g/mol, XLogP of 2.90, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1S,4R)-1-phenyl-2,3-diazabicyclo[2.2.1]hept-2-ene is sourced from PubChem (CID 51020607), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).