C18H16BrNO5 — CID 5102110
prop-2-enyl 2-[(5-bromofuran-2-carbonyl)amino]-3-(4-methoxyphenyl)prop-2-enoate (PubChem CID 5102110) has the molecular formula C18H16BrNO5 and a molecular weight of 406.23 g/mol. Its IUPAC name is prop-2-enyl 2-[(5-bromofuran-2-carbonyl)amino]-3-(4-methoxyphenyl)prop-2-enoate.
| Compound Name | prop-2-enyl 2-[(5-bromofuran-2-carbonyl)amino]-3-(4-methoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 5102110 |
| Molecular Formula | C18H16BrNO5 |
| Molecular Weight | 406.23 g/mol |
| Exact Mass | 405.02 |
| IUPAC Name | prop-2-enyl 2-[(5-bromofuran-2-carbonyl)amino]-3-(4-methoxyphenyl)prop-2-enoate |
| SMILES | C=CCOC(=O)C(=Cc1ccc(OC)cc1)NC(=O)c1ccc(Br)o1 |
| InChI | InChI=1S/C18H16BrNO5/c1-3-10-24-18(22)14(11-12-4-6-13(23-2)7-5-12)20-17(21)15-8-9-16(19)25-15/h3-9,11H,1,10H2,2H3,(H,20,21) |
| InChIKey | PRWHXUNWCDGARZ-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.23 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|