C28H18O4 — CID 51021112
(1S,12S,13R,17R)-1,12-diphenyl-15,18-dioxapentacyclo[10.5.1.02,11.04,9.013,17]octadeca-2,4,6,8,10-pentaene-14,16-dione (PubChem CID 51021112) has the molecular formula C28H18O4 and a molecular weight of 418.45 g/mol. Its IUPAC name is (1S,12S,13R,17R)-1,12-diphenyl-15,18-dioxapentacyclo[10.5.1.02,11.04,9.013,17]octadeca-2,4,6,8,10-pentaene-14,16-dione.
| Compound Name | (1S,12S,13R,17R)-1,12-diphenyl-15,18-dioxapentacyclo[10.5.1.02,11.04,9.013,17]octadeca-2,4,6,8,10-pentaene-14,16-dione |
|---|---|
| PubChem CID | 51021112 |
| Molecular Formula | C28H18O4 |
| Molecular Weight | 418.45 g/mol |
| Exact Mass | 418.12 |
| IUPAC Name | (1S,12S,13R,17R)-1,12-diphenyl-15,18-dioxapentacyclo[10.5.1.02,11.04,9.013,17]octadeca-2,4,6,8,10-pentaene-14,16-dione |
| SMILES | O=C1OC(=O)[C@@H]2[C@@H]1[C@@]1(c3ccccc3)O[C@@]2(c2ccccc2)c2cc3ccccc3cc21 |
| InChI | InChI=1S/C28H18O4/c29-25-23-24(26(30)31-25)28(20-13-5-2-6-14-20)22-16-18-10-8-7-9-17(18)15-21(22)27(23,32-28)19-11-3-1-4-12-19/h1-16,23-24H/t23-,24-,27-,28-/m0/s1 |
| InChIKey | XRZQIPZRFLYILV-LSGCGUROSA-N |
| XLogP | 4.69 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.45 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|