C24H40P2 — CID 51023774
(2S,4R)-1-[2-[(2S,4S)-2,4-di(propan-2-yl)phosphetan-1-yl]phenyl]-2,4-di(propan-2-yl)phosphetane (PubChem CID 51023774) has the molecular formula C24H40P2 and a molecular weight of 390.53 g/mol. Its IUPAC name is (2S,4R)-1-[2-[(2S,4S)-2,4-di(propan-2-yl)phosphetan-1-yl]phenyl]-2,4-di(propan-2-yl)phosphetane.
| Compound Name | (2S,4R)-1-[2-[(2S,4S)-2,4-di(propan-2-yl)phosphetan-1-yl]phenyl]-2,4-di(propan-2-yl)phosphetane |
|---|---|
| PubChem CID | 51023774 |
| Molecular Formula | C24H40P2 |
| Molecular Weight | 390.53 g/mol |
| Exact Mass | 390.26 |
| IUPAC Name | (2S,4R)-1-[2-[(2S,4S)-2,4-di(propan-2-yl)phosphetan-1-yl]phenyl]-2,4-di(propan-2-yl)phosphetane |
| SMILES | CC(C)[C@H]1C[C@@H](C(C)C)P1c1ccccc1P1[C@H](C(C)C)C[C@H]1C(C)C |
| InChI | InChI=1S/C24H40P2/c1-15(2)21-13-22(16(3)4)25(21)19-11-9-10-12-20(19)26-23(17(5)6)14-24(26)18(7)8/h9-12,15-18,21-24H,13-14H2,1-8H3/t21-,22-,23-,24+,26?/m0/s1 |
| InChIKey | NECNYAMJCGALHP-UOKHFBGGSA-N |
| XLogP | 6.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.53 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|