C19H21N5O3S — CID 510291
N-[5-(2-acetamidoethylamino)-1,3,4-thiadiazol-2-yl]-2-ethoxynaphthalene-1-carboxamide (PubChem CID 510291) has the molecular formula C19H21N5O3S and a molecular weight of 399.48 g/mol. Its IUPAC name is N-[5-(2-acetamidoethylamino)-1,3,4-thiadiazol-2-yl]-2-ethoxynaphthalene-1-carboxamide.
| Compound Name | N-[5-(2-acetamidoethylamino)-1,3,4-thiadiazol-2-yl]-2-ethoxynaphthalene-1-carboxamide |
|---|---|
| PubChem CID | 510291 |
| Molecular Formula | C19H21N5O3S |
| Molecular Weight | 399.48 g/mol |
| Exact Mass | 399.14 |
| IUPAC Name | N-[5-(2-acetamidoethylamino)-1,3,4-thiadiazol-2-yl]-2-ethoxynaphthalene-1-carboxamide |
| SMILES | CCOc1ccc2ccccc2c1C(=O)Nc1nnc(NCCNC(C)=O)s1 |
| InChI | InChI=1S/C19H21N5O3S/c1-3-27-15-9-8-13-6-4-5-7-14(13)16(15)17(26)22-19-24-23-18(28-19)21-11-10-20-12(2)25/h4-9H,3,10-11H2,1-2H3,(H,20,25)(H,21,23)(H,22,24,26) |
| InChIKey | WWIXLTWABDAKSB-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 105.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.48 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|