C19H20BClN2O2 — CID 51029825
2-(4-chlorophenyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazolo[1,5-a]pyridine (PubChem CID 51029825) has the molecular formula C19H20BClN2O2 and a molecular weight of 354.65 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazolo[1,5-a]pyridine.
| Compound Name | 2-(4-chlorophenyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 51029825 |
| Molecular Formula | C19H20BClN2O2 |
| Molecular Weight | 354.65 g/mol |
| Exact Mass | 354.13 |
| IUPAC Name | 2-(4-chlorophenyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazolo[1,5-a]pyridine |
| SMILES | CC1(C)OB(c2ccn3nc(-c4ccc(Cl)cc4)cc3c2)OC1(C)C |
| InChI | InChI=1S/C19H20BClN2O2/c1-18(2)19(3,4)25-20(24-18)14-9-10-23-16(11-14)12-17(22-23)13-5-7-15(21)8-6-13/h5-12H,1-4H3 |
| InChIKey | XVVZILIUNFPZFP-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 35.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.65 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|