About 3-[(5-oxo-2-phenyl-2,3-dihydro-1,4-benzothiazepin-4-yl)methyl]benzonitrile
3-[(5-oxo-2-phenyl-2,3-dihydro-1,4-benzothiazepin-4-yl)methyl]benzonitrile (PubChem CID 51029836) has the molecular formula C23H18N2OS
and a molecular weight of 370.48 g/mol. Its IUPAC name is 3-[(5-oxo-2-phenyl-2,3-dihydro-1,4-benzothiazepin-4-yl)methyl]benzonitrile.
Molecular Properties
| Compound Name | 3-[(5-oxo-2-phenyl-2,3-dihydro-1,4-benzothiazepin-4-yl)methyl]benzonitrile |
| PubChem CID | 51029836 |
| Molecular Formula | C23H18N2OS |
| Molecular Weight | 370.48 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | 3-[(5-oxo-2-phenyl-2,3-dihydro-1,4-benzothiazepin-4-yl)methyl]benzonitrile |
| SMILES | N#Cc1cccc(CN2CC(c3ccccc3)Sc3ccccc3C2=O)c1 |
| InChI | InChI=1S/C23H18N2OS/c24-14-17-7-6-8-18(13-17)15-25-16-22(19-9-2-1-3-10-19)27-21-12-5-4-11-20(21)23(25)26/h1-13,22H,15-16H2 |
| InChIKey | LJCPOTSDXPGTOK-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 370.48 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[(5-oxo-2-phenyl-2,3-dihydro-1,4-benzothiazepin-4-yl)methyl]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(5-oxo-2-phenyl-2,3-dihydro-1,4-benzothiazepin-4-yl)methyl]benzonitrile?
The IUPAC name of 3-[(5-oxo-2-phenyl-2,3-dihydro-1,4-benzothiazepin-4-yl)methyl]benzonitrile (CID 51029836) is 3-[(5-oxo-2-phenyl-2,3-dihydro-1,4-benzothiazepin-4-yl)methyl]benzonitrile.
What is the SMILES notation for 3-[(5-oxo-2-phenyl-2,3-dihydro-1,4-benzothiazepin-4-yl)methyl]benzonitrile?
The canonical SMILES for 3-[(5-oxo-2-phenyl-2,3-dihydro-1,4-benzothiazepin-4-yl)methyl]benzonitrile is N#Cc1cccc(CN2CC(c3ccccc3)Sc3ccccc3C2=O)c1.
What is the InChIKey of 3-[(5-oxo-2-phenyl-2,3-dihydro-1,4-benzothiazepin-4-yl)methyl]benzonitrile?
The InChIKey is LJCPOTSDXPGTOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H18N2OS/c24-14-17-7-6-8-18(13-17)15-25-16-22(19-9-2-1-3-10-19)27-21-12-5-4-11-20(21)23(25)26/h1-13,22H,15-16H2.
What are the key properties of 3-[(5-oxo-2-phenyl-2,3-dihydro-1,4-benzothiazepin-4-yl)methyl]benzonitrile?
3-[(5-oxo-2-phenyl-2,3-dihydro-1,4-benzothiazepin-4-yl)methyl]benzonitrile has a molecular weight of 370.48 g/mol, XLogP of 5.05, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(5-oxo-2-phenyl-2,3-dihydro-1,4-benzothiazepin-4-yl)methyl]benzonitrile is sourced from PubChem (CID 51029836), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).