About (4S)-3-imidazo[1,2-a]pyridin-7-yl-4-phenyl-1,3-oxazolidin-2-one
(4S)-3-imidazo[1,2-a]pyridin-7-yl-4-phenyl-1,3-oxazolidin-2-one (PubChem CID 51030219) has the molecular formula C16H13N3O2
and a molecular weight of 279.30 g/mol. Its IUPAC name is (4S)-3-imidazo[1,2-a]pyridin-7-yl-4-phenyl-1,3-oxazolidin-2-one.
Molecular Properties
| Compound Name | (4S)-3-imidazo[1,2-a]pyridin-7-yl-4-phenyl-1,3-oxazolidin-2-one |
| PubChem CID | 51030219 |
| Molecular Formula | C16H13N3O2 |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | (4S)-3-imidazo[1,2-a]pyridin-7-yl-4-phenyl-1,3-oxazolidin-2-one |
| SMILES | O=C1OC[C@H](c2ccccc2)N1c1ccn2ccnc2c1 |
| InChI | InChI=1S/C16H13N3O2/c20-16-19(13-6-8-18-9-7-17-15(18)10-13)14(11-21-16)12-4-2-1-3-5-12/h1-10,14H,11H2/t14-/m1/s1 |
| InChIKey | CABZQJPYSKQBIU-CQSZACIVSA-N |
| XLogP | 3.03 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (4S)-3-imidazo[1,2-a]pyridin-7-yl-4-phenyl-1,3-oxazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-3-imidazo[1,2-a]pyridin-7-yl-4-phenyl-1,3-oxazolidin-2-one?
The IUPAC name of (4S)-3-imidazo[1,2-a]pyridin-7-yl-4-phenyl-1,3-oxazolidin-2-one (CID 51030219) is (4S)-3-imidazo[1,2-a]pyridin-7-yl-4-phenyl-1,3-oxazolidin-2-one.
What is the SMILES notation for (4S)-3-imidazo[1,2-a]pyridin-7-yl-4-phenyl-1,3-oxazolidin-2-one?
The canonical SMILES for (4S)-3-imidazo[1,2-a]pyridin-7-yl-4-phenyl-1,3-oxazolidin-2-one is O=C1OC[C@H](c2ccccc2)N1c1ccn2ccnc2c1.
What is the InChIKey of (4S)-3-imidazo[1,2-a]pyridin-7-yl-4-phenyl-1,3-oxazolidin-2-one?
The InChIKey is CABZQJPYSKQBIU-CQSZACIVSA-N. The full InChI is InChI=1S/C16H13N3O2/c20-16-19(13-6-8-18-9-7-17-15(18)10-13)14(11-21-16)12-4-2-1-3-5-12/h1-10,14H,11H2/t14-/m1/s1.
What are the key properties of (4S)-3-imidazo[1,2-a]pyridin-7-yl-4-phenyl-1,3-oxazolidin-2-one?
(4S)-3-imidazo[1,2-a]pyridin-7-yl-4-phenyl-1,3-oxazolidin-2-one has a molecular weight of 279.30 g/mol, XLogP of 3.03, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-3-imidazo[1,2-a]pyridin-7-yl-4-phenyl-1,3-oxazolidin-2-one is sourced from PubChem (CID 51030219), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).