C22H17N3O2 — CID 51030220
(4S,5R)-3-imidazo[1,2-a]pyridin-7-yl-4,5-diphenyl-1,3-oxazolidin-2-one (PubChem CID 51030220) has the molecular formula C22H17N3O2 and a molecular weight of 355.40 g/mol. Its IUPAC name is (4S,5R)-3-imidazo[1,2-a]pyridin-7-yl-4,5-diphenyl-1,3-oxazolidin-2-one.
| Compound Name | (4S,5R)-3-imidazo[1,2-a]pyridin-7-yl-4,5-diphenyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 51030220 |
| Molecular Formula | C22H17N3O2 |
| Molecular Weight | 355.40 g/mol |
| Exact Mass | 355.13 |
| IUPAC Name | (4S,5R)-3-imidazo[1,2-a]pyridin-7-yl-4,5-diphenyl-1,3-oxazolidin-2-one |
| SMILES | O=C1O[C@H](c2ccccc2)[C@H](c2ccccc2)N1c1ccn2ccnc2c1 |
| InChI | InChI=1S/C22H17N3O2/c26-22-25(18-11-13-24-14-12-23-19(24)15-18)20(16-7-3-1-4-8-16)21(27-22)17-9-5-2-6-10-17/h1-15,20-21H/t20-,21+/m0/s1 |
| InChIKey | JBIIZMJOBAPLOZ-LEWJYISDSA-N |
| XLogP | 4.77 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.40 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |