C20H18F2N4O2 — CID 51030542
2-[4-(6-amino-2,5-difluoro-3-pyridinyl)phenyl]-N-[5-(1-methylcyclopropyl)-1,2-oxazol-3-yl]acetamide (PubChem CID 51030542) has the molecular formula C20H18F2N4O2 and a molecular weight of 384.39 g/mol. Its IUPAC name is 2-[4-(6-amino-2,5-difluoro-3-pyridinyl)phenyl]-N-[5-(1-methylcyclopropyl)-1,2-oxazol-3-yl]acetamide.
| Compound Name | 2-[4-(6-amino-2,5-difluoro-3-pyridinyl)phenyl]-N-[5-(1-methylcyclopropyl)-1,2-oxazol-3-yl]acetamide |
|---|---|
| PubChem CID | 51030542 |
| Molecular Formula | C20H18F2N4O2 |
| Molecular Weight | 384.39 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | 2-[4-(6-amino-2,5-difluoro-3-pyridinyl)phenyl]-N-[5-(1-methylcyclopropyl)-1,2-oxazol-3-yl]acetamide |
| SMILES | CC1(c2cc(NC(=O)Cc3ccc(-c4cc(F)c(N)nc4F)cc3)no2)CC1 |
| InChI | InChI=1S/C20H18F2N4O2/c1-20(6-7-20)15-10-16(26-28-15)24-17(27)8-11-2-4-12(5-3-11)13-9-14(21)19(23)25-18(13)22/h2-5,9-10H,6-8H2,1H3,(H2,23,25)(H,24,26,27) |
| InChIKey | UAVMABCMUOSEPJ-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 94.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.39 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|