C25H21N7O2S — CID 51030834
5-phenyl-4-(pyridin-2-ylmethylamino)-2-[5-(sulfamoylamino)-3-pyridinyl]quinazoline (PubChem CID 51030834) has the molecular formula C25H21N7O2S and a molecular weight of 483.56 g/mol. Its IUPAC name is 5-phenyl-4-(pyridin-2-ylmethylamino)-2-[5-(sulfamoylamino)-3-pyridinyl]quinazoline.
| Compound Name | 5-phenyl-4-(pyridin-2-ylmethylamino)-2-[5-(sulfamoylamino)-3-pyridinyl]quinazoline |
|---|---|
| PubChem CID | 51030834 |
| Molecular Formula | C25H21N7O2S |
| Molecular Weight | 483.56 g/mol |
| Exact Mass | 483.15 |
| IUPAC Name | 5-phenyl-4-(pyridin-2-ylmethylamino)-2-[5-(sulfamoylamino)-3-pyridinyl]quinazoline |
| SMILES | NS(=O)(=O)Nc1cncc(-c2nc(NCc3ccccn3)c3c(-c4ccccc4)cccc3n2)c1 |
| InChI | InChI=1S/C25H21N7O2S/c26-35(33,34)32-20-13-18(14-27-15-20)24-30-22-11-6-10-21(17-7-2-1-3-8-17)23(22)25(31-24)29-16-19-9-4-5-12-28-19/h1-15,32H,16H2,(H2,26,33,34)(H,29,30,31) |
| InChIKey | GPYUSYNKDNQBNE-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 135.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.56 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |