C24H24FN5O2 — CID 51031046
6-[3-(4-fluorophenyl)-5-(3-hydroxypropylamino)-1-methylpyrazol-4-yl]-2-(2-methylphenyl)pyridazin-3-one (PubChem CID 51031046) has the molecular formula C24H24FN5O2 and a molecular weight of 433.49 g/mol. Its IUPAC name is 6-[3-(4-fluorophenyl)-5-(3-hydroxypropylamino)-1-methylpyrazol-4-yl]-2-(2-methylphenyl)pyridazin-3-one.
| Compound Name | 6-[3-(4-fluorophenyl)-5-(3-hydroxypropylamino)-1-methylpyrazol-4-yl]-2-(2-methylphenyl)pyridazin-3-one |
|---|---|
| PubChem CID | 51031046 |
| Molecular Formula | C24H24FN5O2 |
| Molecular Weight | 433.49 g/mol |
| Exact Mass | 433.19 |
| IUPAC Name | 6-[3-(4-fluorophenyl)-5-(3-hydroxypropylamino)-1-methylpyrazol-4-yl]-2-(2-methylphenyl)pyridazin-3-one |
| SMILES | Cc1ccccc1-n1nc(-c2c(-c3ccc(F)cc3)nn(C)c2NCCCO)ccc1=O |
| InChI | InChI=1S/C24H24FN5O2/c1-16-6-3-4-7-20(16)30-21(32)13-12-19(27-30)22-23(17-8-10-18(25)11-9-17)28-29(2)24(22)26-14-5-15-31/h3-4,6-13,26,31H,5,14-15H2,1-2H3 |
| InChIKey | XJVWGLLFVRSHPK-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 84.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.49 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|