C22H27BrN2O6 — CID 5103165
1-(3-bromo-4,5-dimethoxyphenyl)-5-cyclohexyl-3-methyl-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid (PubChem CID 5103165) has the molecular formula C22H27BrN2O6 and a molecular weight of 495.37 g/mol. Its IUPAC name is 1-(3-bromo-4,5-dimethoxyphenyl)-5-cyclohexyl-3-methyl-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid.
| Compound Name | 1-(3-bromo-4,5-dimethoxyphenyl)-5-cyclohexyl-3-methyl-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 5103165 |
| Molecular Formula | C22H27BrN2O6 |
| Molecular Weight | 495.37 g/mol |
| Exact Mass | 494.11 |
| IUPAC Name | 1-(3-bromo-4,5-dimethoxyphenyl)-5-cyclohexyl-3-methyl-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
| SMILES | COc1cc(C2NC(C)(C(=O)O)C3C(=O)N(C4CCCCC4)C(=O)C23)cc(Br)c1OC |
| InChI | InChI=1S/C22H27BrN2O6/c1-22(21(28)29)16-15(19(26)25(20(16)27)12-7-5-4-6-8-12)17(24-22)11-9-13(23)18(31-3)14(10-11)30-2/h9-10,12,15-17,24H,4-8H2,1-3H3,(H,28,29) |
| InChIKey | JJIYZPOJSSNCNY-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.37 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|