C11H22ClN — CID 51032063
(1R,2R,3R,5S)-N,2,6,6-tetramethylbicyclo[3.1.1]heptan-3-amine;hydrochloride (PubChem CID 51032063) has the molecular formula C11H22ClN and a molecular weight of 203.76 g/mol. Its IUPAC name is (1R,2R,3R,5S)-N,2,6,6-tetramethylbicyclo[3.1.1]heptan-3-amine;hydrochloride.
| Compound Name | (1R,2R,3R,5S)-N,2,6,6-tetramethylbicyclo[3.1.1]heptan-3-amine;hydrochloride |
|---|---|
| PubChem CID | 51032063 |
| Molecular Formula | C11H22ClN |
| Molecular Weight | 203.76 g/mol |
| Exact Mass | 203.14 |
| IUPAC Name | (1R,2R,3R,5S)-N,2,6,6-tetramethylbicyclo[3.1.1]heptan-3-amine;hydrochloride |
| SMILES | CN[C@@H]1C[C@@H]2C[C@H]([C@H]1C)C2(C)C.Cl |
| InChI | InChI=1S/C11H21N.ClH/c1-7-9-5-8(11(9,2)3)6-10(7)12-4;/h7-10,12H,5-6H2,1-4H3;1H/t7-,8+,9-,10-;/m1./s1 |
| InChIKey | SLBHRUVXKGEGPB-ZSOUGHPYSA-N |
| XLogP | 2.70 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.76 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |