C14H10ClF2N3OS — CID 51032085
1-[(3-chlorobenzoyl)amino]-3-(2,5-difluorophenyl)thiourea (PubChem CID 51032085) has the molecular formula C14H10ClF2N3OS and a molecular weight of 341.77 g/mol. Its IUPAC name is 1-[(3-chlorobenzoyl)amino]-3-(2,5-difluorophenyl)thiourea.
| Compound Name | 1-[(3-chlorobenzoyl)amino]-3-(2,5-difluorophenyl)thiourea |
|---|---|
| PubChem CID | 51032085 |
| Molecular Formula | C14H10ClF2N3OS |
| Molecular Weight | 341.77 g/mol |
| Exact Mass | 341.02 |
| IUPAC Name | 1-[(3-chlorobenzoyl)amino]-3-(2,5-difluorophenyl)thiourea |
| SMILES | O=C(NNC(=S)Nc1cc(F)ccc1F)c1cccc(Cl)c1 |
| InChI | InChI=1S/C14H10ClF2N3OS/c15-9-3-1-2-8(6-9)13(21)19-20-14(22)18-12-7-10(16)4-5-11(12)17/h1-7H,(H,19,21)(H2,18,20,22) |
| InChIKey | GTMHEDSSWXSLFN-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.77 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|