C17H22FN — CID 51032219
1-(4-fluorophenyl)-N-[(1R,2R,3R,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]methanimine (PubChem CID 51032219) has the molecular formula C17H22FN and a molecular weight of 259.37 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-N-[(1R,2R,3R,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]methanimine.
| Compound Name | 1-(4-fluorophenyl)-N-[(1R,2R,3R,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]methanimine |
|---|---|
| PubChem CID | 51032219 |
| Molecular Formula | C17H22FN |
| Molecular Weight | 259.37 g/mol |
| Exact Mass | 259.17 |
| IUPAC Name | 1-(4-fluorophenyl)-N-[(1R,2R,3R,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]methanimine |
| SMILES | C[C@@H]1[C@H]2C[C@@H](C[C@H]1/N=C/c1ccc(F)cc1)C2(C)C |
| InChI | InChI=1S/C17H22FN/c1-11-15-8-13(17(15,2)3)9-16(11)19-10-12-4-6-14(18)7-5-12/h4-7,10-11,13,15-16H,8-9H2,1-3H3/b19-10+/t11-,13+,15-,16-/m1/s1 |
| InChIKey | DHARHFOBIHYEQZ-TXWONSHXSA-N |
| XLogP | 4.32 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.37 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|