C10H18N4O3 — CID 51032355
tert-butyl N-[[1-(2-hydroxyethyl)triazol-4-yl]methyl]carbamate (PubChem CID 51032355) has the molecular formula C10H18N4O3 and a molecular weight of 242.28 g/mol. Its IUPAC name is tert-butyl N-[[1-(2-hydroxyethyl)triazol-4-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[1-(2-hydroxyethyl)triazol-4-yl]methyl]carbamate |
|---|---|
| PubChem CID | 51032355 |
| Molecular Formula | C10H18N4O3 |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.14 |
| IUPAC Name | tert-butyl N-[[1-(2-hydroxyethyl)triazol-4-yl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCc1cn(CCO)nn1 |
| InChI | InChI=1S/C10H18N4O3/c1-10(2,3)17-9(16)11-6-8-7-14(4-5-15)13-12-8/h7,15H,4-6H2,1-3H3,(H,11,16) |
| InChIKey | FQJWDRFTAXDERL-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |