C30H31NO9 — CID 51032529
(5S,5aS,8aR,9R)-9-(4-hydroxy-3,5-dimethoxyphenyl)-5-[4-(2-hydroxyethoxymethyl)anilino]-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[5,6-f][1,3]benzodioxol-8-one (PubChem CID 51032529) has the molecular formula C30H31NO9 and a molecular weight of 549.58 g/mol. Its IUPAC name is (5S,5aS,8aR,9R)-9-(4-hydroxy-3,5-dimethoxyphenyl)-5-[4-(2-hydroxyethoxymethyl)anilino]-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[5,6-f][1,3]benzodioxol-8-one.
| Compound Name | (5S,5aS,8aR,9R)-9-(4-hydroxy-3,5-dimethoxyphenyl)-5-[4-(2-hydroxyethoxymethyl)anilino]-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[5,6-f][1,3]benzodioxol-8-one |
|---|---|
| PubChem CID | 51032529 |
| Molecular Formula | C30H31NO9 |
| Molecular Weight | 549.58 g/mol |
| Exact Mass | 549.20 |
| IUPAC Name | (5S,5aS,8aR,9R)-9-(4-hydroxy-3,5-dimethoxyphenyl)-5-[4-(2-hydroxyethoxymethyl)anilino]-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[5,6-f][1,3]benzodioxol-8-one |
| SMILES | COc1cc([C@@H]2c3cc4c(cc3[C@@H](Nc3ccc(COCCO)cc3)[C@H]3COC(=O)[C@H]23)OCO4)cc(OC)c1O |
| InChI | InChI=1S/C30H31NO9/c1-35-24-9-17(10-25(36-2)29(24)33)26-19-11-22-23(40-15-39-22)12-20(19)28(21-14-38-30(34)27(21)26)31-18-5-3-16(4-6-18)13-37-8-7-32/h3-6,9-12,21,26-28,31-33H,7-8,13-15H2,1-2H3/t21-,26+,27-,28+/m0/s1 |
| InChIKey | AWAORDNCJBYLPG-GVQBMFDGSA-N |
| XLogP | 3.73 |
| TPSA | 124.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.58 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|