C23H28Cl2N4O3 — CID 51033108
2-methyl-4,11-bis[2-(methylamino)ethylamino]naphtho[2,3-f][1]benzofuran-5,10-dione;dihydrochloride (PubChem CID 51033108) has the molecular formula C23H28Cl2N4O3 and a molecular weight of 479.41 g/mol. Its IUPAC name is 2-methyl-4,11-bis[2-(methylamino)ethylamino]naphtho[2,3-f][1]benzofuran-5,10-dione;dihydrochloride.
| Compound Name | 2-methyl-4,11-bis[2-(methylamino)ethylamino]naphtho[2,3-f][1]benzofuran-5,10-dione;dihydrochloride |
|---|---|
| PubChem CID | 51033108 |
| Molecular Formula | C23H28Cl2N4O3 |
| Molecular Weight | 479.41 g/mol |
| Exact Mass | 478.15 |
| IUPAC Name | 2-methyl-4,11-bis[2-(methylamino)ethylamino]naphtho[2,3-f][1]benzofuran-5,10-dione;dihydrochloride |
| SMILES | CNCCNc1c2c(c(NCCNC)c3oc(C)cc13)C(=O)c1ccccc1C2=O.Cl.Cl |
| InChI | InChI=1S/C23H26N4O3.2ClH/c1-13-12-16-19(26-10-8-24-2)17-18(20(23(16)30-13)27-11-9-25-3)22(29)15-7-5-4-6-14(15)21(17)28;;/h4-7,12,24-27H,8-11H2,1-3H3;2*1H |
| InChIKey | QFJNNOKNCDTNLY-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 95.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.41 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diaminobenzene_3', 'substructure': 'N/A'} |
|---|