About methyl N,N'-bis(1,3-benzodioxole-5-carbonyl)carbamimidoselenoate
methyl N,N'-bis(1,3-benzodioxole-5-carbonyl)carbamimidoselenoate (PubChem CID 51033237) has the molecular formula C18H14N2O6Se
and a molecular weight of 433.28 g/mol. Its IUPAC name is methyl N,N'-bis(1,3-benzodioxole-5-carbonyl)carbamimidoselenoate.
Molecular Properties
| Compound Name | methyl N,N'-bis(1,3-benzodioxole-5-carbonyl)carbamimidoselenoate |
| PubChem CID | 51033237 |
| Molecular Formula | C18H14N2O6Se |
| Molecular Weight | 433.28 g/mol |
| Exact Mass | 434.00 |
| IUPAC Name | methyl N,N'-bis(1,3-benzodioxole-5-carbonyl)carbamimidoselenoate |
| SMILES | C[Se]/C(=N\C(=O)c1ccc2c(c1)OCO2)NC(=O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C18H14N2O6Se/c1-27-18(19-16(21)10-2-4-12-14(6-10)25-8-23-12)20-17(22)11-3-5-13-15(7-11)26-9-24-13/h2-7H,8-9H2,1H3,(H,19,20,21,22) |
| InChIKey | AQYQJARIOANYSO-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 95.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 433.28 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze methyl N,N'-bis(1,3-benzodioxole-5-carbonyl)carbamimidoselenoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N,N'-bis(1,3-benzodioxole-5-carbonyl)carbamimidoselenoate?
The IUPAC name of methyl N,N'-bis(1,3-benzodioxole-5-carbonyl)carbamimidoselenoate (CID 51033237) is methyl N,N'-bis(1,3-benzodioxole-5-carbonyl)carbamimidoselenoate.
What is the SMILES notation for methyl N,N'-bis(1,3-benzodioxole-5-carbonyl)carbamimidoselenoate?
The canonical SMILES for methyl N,N'-bis(1,3-benzodioxole-5-carbonyl)carbamimidoselenoate is C[Se]/C(=N\C(=O)c1ccc2c(c1)OCO2)NC(=O)c1ccc2c(c1)OCO2.
What is the InChIKey of methyl N,N'-bis(1,3-benzodioxole-5-carbonyl)carbamimidoselenoate?
The InChIKey is AQYQJARIOANYSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14N2O6Se/c1-27-18(19-16(21)10-2-4-12-14(6-10)25-8-23-12)20-17(22)11-3-5-13-15(7-11)26-9-24-13/h2-7H,8-9H2,1H3,(H,19,20,21,22).
What are the key properties of methyl N,N'-bis(1,3-benzodioxole-5-carbonyl)carbamimidoselenoate?
methyl N,N'-bis(1,3-benzodioxole-5-carbonyl)carbamimidoselenoate has a molecular weight of 433.28 g/mol, XLogP of 1.82, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N,N'-bis(1,3-benzodioxole-5-carbonyl)carbamimidoselenoate is sourced from PubChem (CID 51033237), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).