C28H38Cl2N4O3 — CID 51033259
2-tert-butyl-4,11-bis[2-(dimethylamino)ethylamino]naphtho[2,3-f][1]benzofuran-5,10-dione;dihydrochloride (PubChem CID 51033259) has the molecular formula C28H38Cl2N4O3 and a molecular weight of 549.54 g/mol. Its IUPAC name is 2-tert-butyl-4,11-bis[2-(dimethylamino)ethylamino]naphtho[2,3-f][1]benzofuran-5,10-dione;dihydrochloride.
| Compound Name | 2-tert-butyl-4,11-bis[2-(dimethylamino)ethylamino]naphtho[2,3-f][1]benzofuran-5,10-dione;dihydrochloride |
|---|---|
| PubChem CID | 51033259 |
| Molecular Formula | C28H38Cl2N4O3 |
| Molecular Weight | 549.54 g/mol |
| Exact Mass | 548.23 |
| IUPAC Name | 2-tert-butyl-4,11-bis[2-(dimethylamino)ethylamino]naphtho[2,3-f][1]benzofuran-5,10-dione;dihydrochloride |
| SMILES | CN(C)CCNc1c2c(c(NCCN(C)C)c3oc(C(C)(C)C)cc13)C(=O)c1ccccc1C2=O.Cl.Cl |
| InChI | InChI=1S/C28H36N4O3.2ClH/c1-28(2,3)20-16-19-23(29-12-14-31(4)5)21-22(24(27(19)35-20)30-13-15-32(6)7)26(34)18-11-9-8-10-17(18)25(21)33;;/h8-11,16,29-30H,12-15H2,1-7H3;2*1H |
| InChIKey | QXLAZXQJTGQQTL-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.54 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'diaminobenzene_3', 'substructure': 'N/A'} |
|---|