About methyl (4S,5R)-2-oxo-4-phenyl-1,3-oxazolidine-5-carboxylate
methyl (4S,5R)-2-oxo-4-phenyl-1,3-oxazolidine-5-carboxylate (PubChem CID 51033265) has the molecular formula C11H11NO4
and a molecular weight of 221.21 g/mol. Its IUPAC name is methyl (4S,5R)-2-oxo-4-phenyl-1,3-oxazolidine-5-carboxylate.
Molecular Properties
| Compound Name | methyl (4S,5R)-2-oxo-4-phenyl-1,3-oxazolidine-5-carboxylate |
| PubChem CID | 51033265 |
| Molecular Formula | C11H11NO4 |
| Molecular Weight | 221.21 g/mol |
| Exact Mass | 221.07 |
| IUPAC Name | methyl (4S,5R)-2-oxo-4-phenyl-1,3-oxazolidine-5-carboxylate |
| SMILES | COC(=O)[C@@H]1OC(=O)N[C@H]1c1ccccc1 |
| InChI | InChI=1S/C11H11NO4/c1-15-10(13)9-8(12-11(14)16-9)7-5-3-2-4-6-7/h2-6,8-9H,1H3,(H,12,14)/t8-,9+/m0/s1 |
| InChIKey | OFJHCOWGFPMLTB-DTWKUNHWSA-N |
| XLogP | 1.01 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.21 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl (4S,5R)-2-oxo-4-phenyl-1,3-oxazolidine-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (4S,5R)-2-oxo-4-phenyl-1,3-oxazolidine-5-carboxylate?
The IUPAC name of methyl (4S,5R)-2-oxo-4-phenyl-1,3-oxazolidine-5-carboxylate (CID 51033265) is methyl (4S,5R)-2-oxo-4-phenyl-1,3-oxazolidine-5-carboxylate.
What is the SMILES notation for methyl (4S,5R)-2-oxo-4-phenyl-1,3-oxazolidine-5-carboxylate?
The canonical SMILES for methyl (4S,5R)-2-oxo-4-phenyl-1,3-oxazolidine-5-carboxylate is COC(=O)[C@@H]1OC(=O)N[C@H]1c1ccccc1.
What is the InChIKey of methyl (4S,5R)-2-oxo-4-phenyl-1,3-oxazolidine-5-carboxylate?
The InChIKey is OFJHCOWGFPMLTB-DTWKUNHWSA-N. The full InChI is InChI=1S/C11H11NO4/c1-15-10(13)9-8(12-11(14)16-9)7-5-3-2-4-6-7/h2-6,8-9H,1H3,(H,12,14)/t8-,9+/m0/s1.
What are the key properties of methyl (4S,5R)-2-oxo-4-phenyl-1,3-oxazolidine-5-carboxylate?
methyl (4S,5R)-2-oxo-4-phenyl-1,3-oxazolidine-5-carboxylate has a molecular weight of 221.21 g/mol, XLogP of 1.01, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (4S,5R)-2-oxo-4-phenyl-1,3-oxazolidine-5-carboxylate is sourced from PubChem (CID 51033265), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).