About benzyl N,N'-bis(1,3-benzodioxole-5-carbonyl)carbamimidoselenoate
benzyl N,N'-bis(1,3-benzodioxole-5-carbonyl)carbamimidoselenoate (PubChem CID 51033379) has the molecular formula C24H18N2O6Se
and a molecular weight of 509.38 g/mol. Its IUPAC name is benzyl N,N'-bis(1,3-benzodioxole-5-carbonyl)carbamimidoselenoate.
Molecular Properties
| Compound Name | benzyl N,N'-bis(1,3-benzodioxole-5-carbonyl)carbamimidoselenoate |
| PubChem CID | 51033379 |
| Molecular Formula | C24H18N2O6Se |
| Molecular Weight | 509.38 g/mol |
| Exact Mass | 510.03 |
| IUPAC Name | benzyl N,N'-bis(1,3-benzodioxole-5-carbonyl)carbamimidoselenoate |
| SMILES | O=C(/N=C(/NC(=O)c1ccc2c(c1)OCO2)[Se]Cc1ccccc1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C24H18N2O6Se/c27-22(16-6-8-18-20(10-16)31-13-29-18)25-24(33-12-15-4-2-1-3-5-15)26-23(28)17-7-9-19-21(11-17)32-14-30-19/h1-11H,12-14H2,(H,25,26,27,28) |
| InChIKey | SPVRICPGYXEALU-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 95.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 509.38 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze benzyl N,N'-bis(1,3-benzodioxole-5-carbonyl)carbamimidoselenoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl N,N'-bis(1,3-benzodioxole-5-carbonyl)carbamimidoselenoate?
The IUPAC name of benzyl N,N'-bis(1,3-benzodioxole-5-carbonyl)carbamimidoselenoate (CID 51033379) is benzyl N,N'-bis(1,3-benzodioxole-5-carbonyl)carbamimidoselenoate.
What is the SMILES notation for benzyl N,N'-bis(1,3-benzodioxole-5-carbonyl)carbamimidoselenoate?
The canonical SMILES for benzyl N,N'-bis(1,3-benzodioxole-5-carbonyl)carbamimidoselenoate is O=C(/N=C(/NC(=O)c1ccc2c(c1)OCO2)[Se]Cc1ccccc1)c1ccc2c(c1)OCO2.
What is the InChIKey of benzyl N,N'-bis(1,3-benzodioxole-5-carbonyl)carbamimidoselenoate?
The InChIKey is SPVRICPGYXEALU-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H18N2O6Se/c27-22(16-6-8-18-20(10-16)31-13-29-18)25-24(33-12-15-4-2-1-3-5-15)26-23(28)17-7-9-19-21(11-17)32-14-30-19/h1-11H,12-14H2,(H,25,26,27,28).
What are the key properties of benzyl N,N'-bis(1,3-benzodioxole-5-carbonyl)carbamimidoselenoate?
benzyl N,N'-bis(1,3-benzodioxole-5-carbonyl)carbamimidoselenoate has a molecular weight of 509.38 g/mol, XLogP of 2.97, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl N,N'-bis(1,3-benzodioxole-5-carbonyl)carbamimidoselenoate is sourced from PubChem (CID 51033379), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).