C26H25F6N3O2 — CID 51033450
N-[3,5-bis(trifluoromethyl)phenyl]-1-(2,6-dimethylphenyl)-5-oxo-3-(1,2,3,6-tetrahydropyridin-4-yl)pyrrolidine-3-carboxamide (PubChem CID 51033450) has the molecular formula C26H25F6N3O2 and a molecular weight of 525.49 g/mol. Its IUPAC name is N-[3,5-bis(trifluoromethyl)phenyl]-1-(2,6-dimethylphenyl)-5-oxo-3-(1,2,3,6-tetrahydropyridin-4-yl)pyrrolidine-3-carboxamide.
| Compound Name | N-[3,5-bis(trifluoromethyl)phenyl]-1-(2,6-dimethylphenyl)-5-oxo-3-(1,2,3,6-tetrahydropyridin-4-yl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 51033450 |
| Molecular Formula | C26H25F6N3O2 |
| Molecular Weight | 525.49 g/mol |
| Exact Mass | 525.19 |
| IUPAC Name | N-[3,5-bis(trifluoromethyl)phenyl]-1-(2,6-dimethylphenyl)-5-oxo-3-(1,2,3,6-tetrahydropyridin-4-yl)pyrrolidine-3-carboxamide |
| SMILES | Cc1cccc(C)c1N1CC(C(=O)Nc2cc(C(F)(F)F)cc(C(F)(F)F)c2)(C2=CCNCC2)CC1=O |
| InChI | InChI=1S/C26H25F6N3O2/c1-15-4-3-5-16(2)22(15)35-14-24(13-21(35)36,17-6-8-33-9-7-17)23(37)34-20-11-18(25(27,28)29)10-19(12-20)26(30,31)32/h3-6,10-12,33H,7-9,13-14H2,1-2H3,(H,34,37) |
| InChIKey | DSYNTRLRWZXWNU-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.49 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|