C26H22ClNO3 — CID 51034776
3-[[(3E)-3-[1-(4-chlorophenyl)-2-methylpropylidene]-2-oxoindol-1-yl]methyl]benzoic acid (PubChem CID 51034776) has the molecular formula C26H22ClNO3 and a molecular weight of 431.92 g/mol. Its IUPAC name is 3-[[(3E)-3-[1-(4-chlorophenyl)-2-methylpropylidene]-2-oxoindol-1-yl]methyl]benzoic acid.
| Compound Name | 3-[[(3E)-3-[1-(4-chlorophenyl)-2-methylpropylidene]-2-oxoindol-1-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 51034776 |
| Molecular Formula | C26H22ClNO3 |
| Molecular Weight | 431.92 g/mol |
| Exact Mass | 431.13 |
| IUPAC Name | 3-[[(3E)-3-[1-(4-chlorophenyl)-2-methylpropylidene]-2-oxoindol-1-yl]methyl]benzoic acid |
| SMILES | CC(C)/C(=C1\C(=O)N(Cc2cccc(C(=O)O)c2)c2ccccc21)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C26H22ClNO3/c1-16(2)23(18-10-12-20(27)13-11-18)24-21-8-3-4-9-22(21)28(25(24)29)15-17-6-5-7-19(14-17)26(30)31/h3-14,16H,15H2,1-2H3,(H,30,31)/b24-23+ |
| InChIKey | JYNUCGGUAIPMJH-WCWDXBQESA-N |
| XLogP | 6.15 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.92 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|