C20H22O6 — CID 51034944
(3aS,4R)-3a-[2-[2-(furan-3-yl)-4-methyl-6-oxo-2,3-dihydropyran-5-yl]ethyl]-4-hydroxy-3,4,5,6-tetrahydro-2-benzofuran-1-one (PubChem CID 51034944) has the molecular formula C20H22O6 and a molecular weight of 358.39 g/mol. Its IUPAC name is (3aS,4R)-3a-[2-[2-(furan-3-yl)-4-methyl-6-oxo-2,3-dihydropyran-5-yl]ethyl]-4-hydroxy-3,4,5,6-tetrahydro-2-benzofuran-1-one.
| Compound Name | (3aS,4R)-3a-[2-[2-(furan-3-yl)-4-methyl-6-oxo-2,3-dihydropyran-5-yl]ethyl]-4-hydroxy-3,4,5,6-tetrahydro-2-benzofuran-1-one |
|---|---|
| PubChem CID | 51034944 |
| Molecular Formula | C20H22O6 |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | (3aS,4R)-3a-[2-[2-(furan-3-yl)-4-methyl-6-oxo-2,3-dihydropyran-5-yl]ethyl]-4-hydroxy-3,4,5,6-tetrahydro-2-benzofuran-1-one |
| SMILES | CC1=C(CC[C@@]23COC(=O)C2=CCC[C@H]3O)C(=O)OC(c2ccoc2)C1 |
| InChI | InChI=1S/C20H22O6/c1-12-9-16(13-6-8-24-10-13)26-18(22)14(12)5-7-20-11-25-19(23)15(20)3-2-4-17(20)21/h3,6,8,10,16-17,21H,2,4-5,7,9,11H2,1H3/t16?,17-,20-/m1/s1 |
| InChIKey | CWWUMNIILGRGJX-HMEKMZBJSA-N |
| XLogP | 2.99 |
| TPSA | 85.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |