C19H14O7 — CID 51035008
(4S,8R)-15-hydroxy-11,18-dimethoxy-7,9,20-trioxapentacyclo[10.8.0.03,10.04,8.014,19]icosa-1(12),2,5,10,14,16,18-heptaen-13-one (PubChem CID 51035008) has the molecular formula C19H14O7 and a molecular weight of 354.31 g/mol. Its IUPAC name is (4S,8R)-15-hydroxy-11,18-dimethoxy-7,9,20-trioxapentacyclo[10.8.0.03,10.04,8.014,19]icosa-1(12),2,5,10,14,16,18-heptaen-13-one.
| Compound Name | (4S,8R)-15-hydroxy-11,18-dimethoxy-7,9,20-trioxapentacyclo[10.8.0.03,10.04,8.014,19]icosa-1(12),2,5,10,14,16,18-heptaen-13-one |
|---|---|
| PubChem CID | 51035008 |
| Molecular Formula | C19H14O7 |
| Molecular Weight | 354.31 g/mol |
| Exact Mass | 354.07 |
| IUPAC Name | (4S,8R)-15-hydroxy-11,18-dimethoxy-7,9,20-trioxapentacyclo[10.8.0.03,10.04,8.014,19]icosa-1(12),2,5,10,14,16,18-heptaen-13-one |
| SMILES | COc1ccc(O)c2c(=O)c3c(OC)c4c(cc3oc12)[C@@H]1C=CO[C@@H]1O4 |
| InChI | InChI=1S/C19H14O7/c1-22-11-4-3-10(20)13-15(21)14-12(25-17(11)13)7-9-8-5-6-24-19(8)26-16(9)18(14)23-2/h3-8,19-20H,1-2H3/t8-,19+/m0/s1 |
| InChIKey | DQGJIGDYGNDNMV-WPCRTTGESA-N |
| XLogP | 3.02 |
| TPSA | 87.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.31 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|