C18H27ClO4 — CID 51035086
1-chloroethoxycarbonyl 2-[(1R,4R,4aS,8aS)-4,7-dimethyl-1,2,3,4,4a,5,6,8a-octahydronaphthalen-1-yl]propanoate (PubChem CID 51035086) has the molecular formula C18H27ClO4 and a molecular weight of 342.86 g/mol. Its IUPAC name is 1-chloroethoxycarbonyl 2-[(1R,4R,4aS,8aS)-4,7-dimethyl-1,2,3,4,4a,5,6,8a-octahydronaphthalen-1-yl]propanoate.
| Compound Name | 1-chloroethoxycarbonyl 2-[(1R,4R,4aS,8aS)-4,7-dimethyl-1,2,3,4,4a,5,6,8a-octahydronaphthalen-1-yl]propanoate |
|---|---|
| PubChem CID | 51035086 |
| Molecular Formula | C18H27ClO4 |
| Molecular Weight | 342.86 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | 1-chloroethoxycarbonyl 2-[(1R,4R,4aS,8aS)-4,7-dimethyl-1,2,3,4,4a,5,6,8a-octahydronaphthalen-1-yl]propanoate |
| SMILES | CC1=C[C@H]2[C@@H](CC1)[C@H](C)CC[C@H]2C(C)C(=O)OC(=O)OC(C)Cl |
| InChI | InChI=1S/C18H27ClO4/c1-10-5-7-14-11(2)6-8-15(16(14)9-10)12(3)17(20)23-18(21)22-13(4)19/h9,11-16H,5-8H2,1-4H3/t11-,12?,13?,14+,15+,16+/m1/s1 |
| InChIKey | MMZAHBPCVLRSLG-IVDIRJAZSA-N |
| XLogP | 4.91 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.86 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|