C48H36Cl2P2Pt+2 — CID 51035227
[(4aZ,8aZ,12aZ,16aZ)-16-diphenylphosphaniumyltetraphenylen-1-yl]-diphenylphosphanium;dichloroplatinum (PubChem CID 51035227) has the molecular formula C48H36Cl2P2Pt+2 and a molecular weight of 940.75 g/mol. Its IUPAC name is [(4aZ,8aZ,12aZ,16aZ)-16-diphenylphosphaniumyltetraphenylen-1-yl]-diphenylphosphanium;dichloroplatinum.
| Compound Name | [(4aZ,8aZ,12aZ,16aZ)-16-diphenylphosphaniumyltetraphenylen-1-yl]-diphenylphosphanium;dichloroplatinum |
|---|---|
| PubChem CID | 51035227 |
| Molecular Formula | C48H36Cl2P2Pt+2 |
| Molecular Weight | 940.75 g/mol |
| Exact Mass | 939.13 |
| IUPAC Name | [(4aZ,8aZ,12aZ,16aZ)-16-diphenylphosphaniumyltetraphenylen-1-yl]-diphenylphosphanium;dichloroplatinum |
| SMILES | Cl[Pt]Cl.c1ccc([PH+](c2ccccc2)c2cccc3/c2=c2/c([PH+](c4ccccc4)c4ccccc4)ccc/c2=c2\cccc\c2=c2/cccc/c2=3)cc1 |
| InChI | InChI=1S/C48H34P2.2ClH.Pt/c1-5-19-35(20-6-1)49(36-21-7-2-8-22-36)45-33-17-31-43-41-29-15-13-27-39(41)40-28-14-16-30-42(40)44-32-18-34-46(48(44)47(43)45)50(37-23-9-3-10-24-37)38-25-11-4-12-26-38;;;/h1-34H;2*1H;/q;;;+2/b40-39-,43-41-,44-42-,48-47-;;; |
| InChIKey | DCJDHCLJAQDBPK-NKUBAAJASA-N |
| XLogP | 9.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 940.75 |
| LogP ≤ 5 | 9.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|