C25H26F6N4O — CID 51035448
1,1,1,3,3,3-hexafluoro-2-[4-[4-[[4-[(3-methylimidazol-4-yl)methyl]piperazin-1-yl]methyl]phenyl]phenyl]propan-2-ol (PubChem CID 51035448) has the molecular formula C25H26F6N4O and a molecular weight of 512.50 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoro-2-[4-[4-[[4-[(3-methylimidazol-4-yl)methyl]piperazin-1-yl]methyl]phenyl]phenyl]propan-2-ol.
| Compound Name | 1,1,1,3,3,3-hexafluoro-2-[4-[4-[[4-[(3-methylimidazol-4-yl)methyl]piperazin-1-yl]methyl]phenyl]phenyl]propan-2-ol |
|---|---|
| PubChem CID | 51035448 |
| Molecular Formula | C25H26F6N4O |
| Molecular Weight | 512.50 g/mol |
| Exact Mass | 512.20 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoro-2-[4-[4-[[4-[(3-methylimidazol-4-yl)methyl]piperazin-1-yl]methyl]phenyl]phenyl]propan-2-ol |
| SMILES | Cn1cncc1CN1CCN(Cc2ccc(-c3ccc(C(O)(C(F)(F)F)C(F)(F)F)cc3)cc2)CC1 |
| InChI | InChI=1S/C25H26F6N4O/c1-33-17-32-14-22(33)16-35-12-10-34(11-13-35)15-18-2-4-19(5-3-18)20-6-8-21(9-7-20)23(36,24(26,27)28)25(29,30)31/h2-9,14,17,36H,10-13,15-16H2,1H3 |
| InChIKey | HAIHMRAPMZVPQH-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 44.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.50 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |