C27H22F3N7O3 — CID 51035881
(3Z)-3-[[5-[3-(cyclopropylamino)-5-[3-(trifluoromethoxy)anilino]anilino]pyrazolo[1,5-a]pyrimidin-3-yl]methylidene]pyrrolidine-2,5-dione (PubChem CID 51035881) has the molecular formula C27H22F3N7O3 and a molecular weight of 549.51 g/mol. Its IUPAC name is (3Z)-3-[[5-[3-(cyclopropylamino)-5-[3-(trifluoromethoxy)anilino]anilino]pyrazolo[1,5-a]pyrimidin-3-yl]methylidene]pyrrolidine-2,5-dione.
| Compound Name | (3Z)-3-[[5-[3-(cyclopropylamino)-5-[3-(trifluoromethoxy)anilino]anilino]pyrazolo[1,5-a]pyrimidin-3-yl]methylidene]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 51035881 |
| Molecular Formula | C27H22F3N7O3 |
| Molecular Weight | 549.51 g/mol |
| Exact Mass | 549.17 |
| IUPAC Name | (3Z)-3-[[5-[3-(cyclopropylamino)-5-[3-(trifluoromethoxy)anilino]anilino]pyrazolo[1,5-a]pyrimidin-3-yl]methylidene]pyrrolidine-2,5-dione |
| SMILES | O=C1C/C(=C/c2cnn3ccc(Nc4cc(Nc5cccc(OC(F)(F)F)c5)cc(NC5CC5)c4)nc23)C(=O)N1 |
| InChI | InChI=1S/C27H22F3N7O3/c28-27(29,30)40-22-3-1-2-18(13-22)33-20-10-19(32-17-4-5-17)11-21(12-20)34-23-6-7-37-25(35-23)16(14-31-37)8-15-9-24(38)36-26(15)39/h1-3,6-8,10-14,17,32-33H,4-5,9H2,(H,34,35)(H,36,38,39)/b15-8- |
| InChIKey | FQPWSCMYAMMJIQ-NVNXTCNLSA-N |
| XLogP | 5.12 |
| TPSA | 121.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.51 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|