C27H27N7O — CID 51035923
1-methyl-3-[4-(4-methylpiperazin-1-yl)phenyl]-4-[4-(1H-pyrrolo[2,3-b]pyridin-5-yl)-2-pyridinyl]imidazol-2-one (PubChem CID 51035923) has the molecular formula C27H27N7O and a molecular weight of 465.56 g/mol. Its IUPAC name is 1-methyl-3-[4-(4-methylpiperazin-1-yl)phenyl]-4-[4-(1H-pyrrolo[2,3-b]pyridin-5-yl)-2-pyridinyl]imidazol-2-one.
| Compound Name | 1-methyl-3-[4-(4-methylpiperazin-1-yl)phenyl]-4-[4-(1H-pyrrolo[2,3-b]pyridin-5-yl)-2-pyridinyl]imidazol-2-one |
|---|---|
| PubChem CID | 51035923 |
| Molecular Formula | C27H27N7O |
| Molecular Weight | 465.56 g/mol |
| Exact Mass | 465.23 |
| IUPAC Name | 1-methyl-3-[4-(4-methylpiperazin-1-yl)phenyl]-4-[4-(1H-pyrrolo[2,3-b]pyridin-5-yl)-2-pyridinyl]imidazol-2-one |
| SMILES | CN1CCN(c2ccc(-n3c(-c4cc(-c5cnc6[nH]ccc6c5)ccn4)cn(C)c3=O)cc2)CC1 |
| InChI | InChI=1S/C27H27N7O/c1-31-11-13-33(14-12-31)22-3-5-23(6-4-22)34-25(18-32(2)27(34)35)24-16-19(7-9-28-24)21-15-20-8-10-29-26(20)30-17-21/h3-10,15-18H,11-14H2,1-2H3,(H,29,30) |
| InChIKey | IWNNMGAWXNTPMV-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 74.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.56 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|