C25H30ClN3O2 — CID 51035942
propan-2-yl 4-(6-chloro-2-methyl-3,4-dihydro-1H-pyrido[3,4-b]indol-9-yl)-3-(6-methyl-3-pyridinyl)butanoate (PubChem CID 51035942) has the molecular formula C25H30ClN3O2 and a molecular weight of 439.99 g/mol. Its IUPAC name is propan-2-yl 4-(6-chloro-2-methyl-3,4-dihydro-1H-pyrido[3,4-b]indol-9-yl)-3-(6-methyl-3-pyridinyl)butanoate.
| Compound Name | propan-2-yl 4-(6-chloro-2-methyl-3,4-dihydro-1H-pyrido[3,4-b]indol-9-yl)-3-(6-methyl-3-pyridinyl)butanoate |
|---|---|
| PubChem CID | 51035942 |
| Molecular Formula | C25H30ClN3O2 |
| Molecular Weight | 439.99 g/mol |
| Exact Mass | 439.20 |
| IUPAC Name | propan-2-yl 4-(6-chloro-2-methyl-3,4-dihydro-1H-pyrido[3,4-b]indol-9-yl)-3-(6-methyl-3-pyridinyl)butanoate |
| SMILES | Cc1ccc(C(CC(=O)OC(C)C)Cn2c3c(c4cc(Cl)ccc42)CCN(C)C3)cn1 |
| InChI | InChI=1S/C25H30ClN3O2/c1-16(2)31-25(30)11-19(18-6-5-17(3)27-13-18)14-29-23-8-7-20(26)12-22(23)21-9-10-28(4)15-24(21)29/h5-8,12-13,16,19H,9-11,14-15H2,1-4H3 |
| InChIKey | QHVZLOYVMDPMKM-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.99 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|