C36H38N8O5 — CID 51036344
4-[[4-[2-[2-(2-benzamidoethoxy)ethoxy]ethylamino]-6-(4-hydroxyanilino)-1,3,5-triazin-2-yl]amino]-N-benzylbenzamide (PubChem CID 51036344) has the molecular formula C36H38N8O5 and a molecular weight of 662.75 g/mol. Its IUPAC name is 4-[[4-[2-[2-(2-benzamidoethoxy)ethoxy]ethylamino]-6-(4-hydroxyanilino)-1,3,5-triazin-2-yl]amino]-N-benzylbenzamide.
| Compound Name | 4-[[4-[2-[2-(2-benzamidoethoxy)ethoxy]ethylamino]-6-(4-hydroxyanilino)-1,3,5-triazin-2-yl]amino]-N-benzylbenzamide |
|---|---|
| PubChem CID | 51036344 |
| Molecular Formula | C36H38N8O5 |
| Molecular Weight | 662.75 g/mol |
| Exact Mass | 662.30 |
| IUPAC Name | 4-[[4-[2-[2-(2-benzamidoethoxy)ethoxy]ethylamino]-6-(4-hydroxyanilino)-1,3,5-triazin-2-yl]amino]-N-benzylbenzamide |
| SMILES | O=C(NCCOCCOCCNc1nc(Nc2ccc(O)cc2)nc(Nc2ccc(C(=O)NCc3ccccc3)cc2)n1)c1ccccc1 |
| InChI | InChI=1S/C36H38N8O5/c45-31-17-15-30(16-18-31)41-36-43-34(38-20-22-49-24-23-48-21-19-37-32(46)27-9-5-2-6-10-27)42-35(44-36)40-29-13-11-28(12-14-29)33(47)39-25-26-7-3-1-4-8-26/h1-18,45H,19-25H2,(H,37,46)(H,39,47)(H3,38,40,41,42,43,44) |
| InChIKey | TYPXQOCPUHDKSH-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 171.65 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.75 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|