About 1-(2,2-dimethylpropyl)-3-methyl-5-piperidin-1-ylimidazo[4,5-b]pyridin-2-one
1-(2,2-dimethylpropyl)-3-methyl-5-piperidin-1-ylimidazo[4,5-b]pyridin-2-one (PubChem CID 51036701) has the molecular formula C17H26N4O
and a molecular weight of 302.42 g/mol. Its IUPAC name is 1-(2,2-dimethylpropyl)-3-methyl-5-piperidin-1-ylimidazo[4,5-b]pyridin-2-one.
Molecular Properties
| Compound Name | 1-(2,2-dimethylpropyl)-3-methyl-5-piperidin-1-ylimidazo[4,5-b]pyridin-2-one |
| PubChem CID | 51036701 |
| Molecular Formula | C17H26N4O |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.21 |
| IUPAC Name | 1-(2,2-dimethylpropyl)-3-methyl-5-piperidin-1-ylimidazo[4,5-b]pyridin-2-one |
| SMILES | Cn1c(=O)n(CC(C)(C)C)c2ccc(N3CCCCC3)nc21 |
| InChI | InChI=1S/C17H26N4O/c1-17(2,3)12-21-13-8-9-14(20-10-6-5-7-11-20)18-15(13)19(4)16(21)22/h8-9H,5-7,10-12H2,1-4H3 |
| InChIKey | ZJBBCZAWPDDFJH-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 43.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(2,2-dimethylpropyl)-3-methyl-5-piperidin-1-ylimidazo[4,5-b]pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,2-dimethylpropyl)-3-methyl-5-piperidin-1-ylimidazo[4,5-b]pyridin-2-one?
The IUPAC name of 1-(2,2-dimethylpropyl)-3-methyl-5-piperidin-1-ylimidazo[4,5-b]pyridin-2-one (CID 51036701) is 1-(2,2-dimethylpropyl)-3-methyl-5-piperidin-1-ylimidazo[4,5-b]pyridin-2-one.
What is the SMILES notation for 1-(2,2-dimethylpropyl)-3-methyl-5-piperidin-1-ylimidazo[4,5-b]pyridin-2-one?
The canonical SMILES for 1-(2,2-dimethylpropyl)-3-methyl-5-piperidin-1-ylimidazo[4,5-b]pyridin-2-one is Cn1c(=O)n(CC(C)(C)C)c2ccc(N3CCCCC3)nc21.
What is the InChIKey of 1-(2,2-dimethylpropyl)-3-methyl-5-piperidin-1-ylimidazo[4,5-b]pyridin-2-one?
The InChIKey is ZJBBCZAWPDDFJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H26N4O/c1-17(2,3)12-21-13-8-9-14(20-10-6-5-7-11-20)18-15(13)19(4)16(21)22/h8-9H,5-7,10-12H2,1-4H3.
What are the key properties of 1-(2,2-dimethylpropyl)-3-methyl-5-piperidin-1-ylimidazo[4,5-b]pyridin-2-one?
1-(2,2-dimethylpropyl)-3-methyl-5-piperidin-1-ylimidazo[4,5-b]pyridin-2-one has a molecular weight of 302.42 g/mol, XLogP of 2.77, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,2-dimethylpropyl)-3-methyl-5-piperidin-1-ylimidazo[4,5-b]pyridin-2-one is sourced from PubChem (CID 51036701), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).