About spiro[adamantane-2,4'-cyclohexane]-1'-amine
spiro[adamantane-2,4'-cyclohexane]-1'-amine (PubChem CID 51036796) has the molecular formula C15H25N
and a molecular weight of 219.37 g/mol. Its IUPAC name is spiro[adamantane-2,4'-cyclohexane]-1'-amine.
Molecular Properties
| Compound Name | spiro[adamantane-2,4'-cyclohexane]-1'-amine |
| PubChem CID | 51036796 |
| Molecular Formula | C15H25N |
| Molecular Weight | 219.37 g/mol |
| Exact Mass | 219.20 |
| IUPAC Name | spiro[adamantane-2,4'-cyclohexane]-1'-amine |
| SMILES | NC1CCC2(CC1)C1CC3CC(C1)CC2C3 |
| InChI | InChI=1S/C15H25N/c16-14-1-3-15(4-2-14)12-6-10-5-11(8-12)9-13(15)7-10/h10-14H,1-9,16H2 |
| InChIKey | VNTMIVFMVGTSHV-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.37 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze spiro[adamantane-2,4'-cyclohexane]-1'-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[adamantane-2,4'-cyclohexane]-1'-amine?
The IUPAC name of spiro[adamantane-2,4'-cyclohexane]-1'-amine (CID 51036796) is spiro[adamantane-2,4'-cyclohexane]-1'-amine.
What is the SMILES notation for spiro[adamantane-2,4'-cyclohexane]-1'-amine?
The canonical SMILES for spiro[adamantane-2,4'-cyclohexane]-1'-amine is NC1CCC2(CC1)C1CC3CC(C1)CC2C3.
What is the InChIKey of spiro[adamantane-2,4'-cyclohexane]-1'-amine?
The InChIKey is VNTMIVFMVGTSHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H25N/c16-14-1-3-15(4-2-14)12-6-10-5-11(8-12)9-13(15)7-10/h10-14H,1-9,16H2.
What are the key properties of spiro[adamantane-2,4'-cyclohexane]-1'-amine?
spiro[adamantane-2,4'-cyclohexane]-1'-amine has a molecular weight of 219.37 g/mol, XLogP of 3.33, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[adamantane-2,4'-cyclohexane]-1'-amine is sourced from PubChem (CID 51036796), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).