C30H33N7O6 — CID 51037176
methyl 4-[[4-[2-[2-(2-benzamidoethoxy)ethoxy]ethylamino]-6-(4-hydroxyanilino)-1,3,5-triazin-2-yl]amino]benzoate (PubChem CID 51037176) has the molecular formula C30H33N7O6 and a molecular weight of 587.64 g/mol. Its IUPAC name is methyl 4-[[4-[2-[2-(2-benzamidoethoxy)ethoxy]ethylamino]-6-(4-hydroxyanilino)-1,3,5-triazin-2-yl]amino]benzoate.
| Compound Name | methyl 4-[[4-[2-[2-(2-benzamidoethoxy)ethoxy]ethylamino]-6-(4-hydroxyanilino)-1,3,5-triazin-2-yl]amino]benzoate |
|---|---|
| PubChem CID | 51037176 |
| Molecular Formula | C30H33N7O6 |
| Molecular Weight | 587.64 g/mol |
| Exact Mass | 587.25 |
| IUPAC Name | methyl 4-[[4-[2-[2-(2-benzamidoethoxy)ethoxy]ethylamino]-6-(4-hydroxyanilino)-1,3,5-triazin-2-yl]amino]benzoate |
| SMILES | COC(=O)c1ccc(Nc2nc(NCCOCCOCCNC(=O)c3ccccc3)nc(Nc3ccc(O)cc3)n2)cc1 |
| InChI | InChI=1S/C30H33N7O6/c1-41-27(40)22-7-9-23(10-8-22)33-29-35-28(36-30(37-29)34-24-11-13-25(38)14-12-24)32-16-18-43-20-19-42-17-15-31-26(39)21-5-3-2-4-6-21/h2-14,38H,15-20H2,1H3,(H,31,39)(H3,32,33,34,35,36,37) |
| InChIKey | UMJRMPRPJMSVNN-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 168.85 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.64 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|