C25H29FN2O — CID 51037183
2-cyclopropyl-9-[2-fluoro-2-(4-methoxyphenyl)propyl]-6-methyl-3,4-dihydro-1H-pyrido[3,4-b]indole (PubChem CID 51037183) has the molecular formula C25H29FN2O and a molecular weight of 392.52 g/mol. Its IUPAC name is 2-cyclopropyl-9-[2-fluoro-2-(4-methoxyphenyl)propyl]-6-methyl-3,4-dihydro-1H-pyrido[3,4-b]indole.
| Compound Name | 2-cyclopropyl-9-[2-fluoro-2-(4-methoxyphenyl)propyl]-6-methyl-3,4-dihydro-1H-pyrido[3,4-b]indole |
|---|---|
| PubChem CID | 51037183 |
| Molecular Formula | C25H29FN2O |
| Molecular Weight | 392.52 g/mol |
| Exact Mass | 392.23 |
| IUPAC Name | 2-cyclopropyl-9-[2-fluoro-2-(4-methoxyphenyl)propyl]-6-methyl-3,4-dihydro-1H-pyrido[3,4-b]indole |
| SMILES | COc1ccc(C(C)(F)Cn2c3c(c4cc(C)ccc42)CCN(C2CC2)C3)cc1 |
| InChI | InChI=1S/C25H29FN2O/c1-17-4-11-23-22(14-17)21-12-13-27(19-7-8-19)15-24(21)28(23)16-25(2,26)18-5-9-20(29-3)10-6-18/h4-6,9-11,14,19H,7-8,12-13,15-16H2,1-3H3 |
| InChIKey | UJNBZVCUAHQMNR-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 17.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.52 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|