C20H4Br4ClI3O5 — CID 51037209
4,5,6,7-tetrabromo-4'-chloro-3',6'-dihydroxy-2',5',7'-triiodospiro[2-benzofuran-3,9'-xanthene]-1-one (PubChem CID 51037209) has the molecular formula C20H4Br4ClI3O5 and a molecular weight of 1060.03 g/mol. Its IUPAC name is 4,5,6,7-tetrabromo-4'-chloro-3',6'-dihydroxy-2',5',7'-triiodospiro[2-benzofuran-3,9'-xanthene]-1-one.
| Compound Name | 4,5,6,7-tetrabromo-4'-chloro-3',6'-dihydroxy-2',5',7'-triiodospiro[2-benzofuran-3,9'-xanthene]-1-one |
|---|---|
| PubChem CID | 51037209 |
| Molecular Formula | C20H4Br4ClI3O5 |
| Molecular Weight | 1060.03 g/mol |
| Exact Mass | 1055.36 |
| IUPAC Name | 4,5,6,7-tetrabromo-4'-chloro-3',6'-dihydroxy-2',5',7'-triiodospiro[2-benzofuran-3,9'-xanthene]-1-one |
| SMILES | O=C1OC2(c3cc(I)c(O)c(Cl)c3Oc3c2cc(I)c(O)c3I)c2c(Br)c(Br)c(Br)c(Br)c21 |
| InChI | InChI=1S/C20H4Br4ClI3O5/c21-9-7-8(10(22)12(24)11(9)23)20(33-19(7)31)3-1-5(26)15(29)13(25)17(3)32-18-4(20)2-6(27)16(30)14(18)28/h1-2,29-30H |
| InChIKey | OTVCURBZZGYKKC-UHFFFAOYSA-N |
| XLogP | 9.18 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1060.03 |
| LogP ≤ 5 | 9.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|