C36H36F2N8O5 — CID 51037389
4-[[4-[2-[2-(2-benzamidoethoxy)ethoxy]ethylamino]-6-(4-hydroxyanilino)-1,3,5-triazin-2-yl]amino]-N-[(3,5-difluorophenyl)methyl]benzamide (PubChem CID 51037389) has the molecular formula C36H36F2N8O5 and a molecular weight of 698.73 g/mol. Its IUPAC name is 4-[[4-[2-[2-(2-benzamidoethoxy)ethoxy]ethylamino]-6-(4-hydroxyanilino)-1,3,5-triazin-2-yl]amino]-N-[(3,5-difluorophenyl)methyl]benzamide.
| Compound Name | 4-[[4-[2-[2-(2-benzamidoethoxy)ethoxy]ethylamino]-6-(4-hydroxyanilino)-1,3,5-triazin-2-yl]amino]-N-[(3,5-difluorophenyl)methyl]benzamide |
|---|---|
| PubChem CID | 51037389 |
| Molecular Formula | C36H36F2N8O5 |
| Molecular Weight | 698.73 g/mol |
| Exact Mass | 698.28 |
| IUPAC Name | 4-[[4-[2-[2-(2-benzamidoethoxy)ethoxy]ethylamino]-6-(4-hydroxyanilino)-1,3,5-triazin-2-yl]amino]-N-[(3,5-difluorophenyl)methyl]benzamide |
| SMILES | O=C(NCCOCCOCCNc1nc(Nc2ccc(O)cc2)nc(Nc2ccc(C(=O)NCc3cc(F)cc(F)c3)cc2)n1)c1ccccc1 |
| InChI | InChI=1S/C36H36F2N8O5/c37-27-20-24(21-28(38)22-27)23-41-33(49)26-6-8-29(9-7-26)42-35-44-34(45-36(46-35)43-30-10-12-31(47)13-11-30)40-15-17-51-19-18-50-16-14-39-32(48)25-4-2-1-3-5-25/h1-13,20-22,47H,14-19,23H2,(H,39,48)(H,41,49)(H3,40,42,43,44,45,46) |
| InChIKey | AOUBAWARGOELQF-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 171.65 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 51 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.73 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|